C6H14N4O4 — CID 129434404
2-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]guanidine (PubChem CID 129434404) has the molecular formula C6H14N4O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]guanidine.
| Compound Name | 2-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]guanidine |
|---|---|
| PubChem CID | 129434404 |
| Molecular Formula | C6H14N4O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 2-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]guanidine |
| SMILES | NC(N)=NN=C[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H14N4O4/c7-6(8)10-9-1-3(12)5(14)4(13)2-11/h1,3-5,11-14H,2H2,(H4,7,8,10)/t3-,4+,5-/m0/s1 |
| InChIKey | VZOXDEQSHCNUSR-LMVFSUKVSA-N |
| XLogP | -3.68 |
| TPSA | 157.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|