C7H15N3O4S — CID 10014380
1-methyl-1-[(Z)-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]thiourea (PubChem CID 10014380) has the molecular formula C7H15N3O4S and a molecular weight of 237.28 g/mol. Its IUPAC name is 1-methyl-1-[(Z)-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]thiourea.
| Compound Name | 1-methyl-1-[(Z)-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]thiourea |
|---|---|
| PubChem CID | 10014380 |
| Molecular Formula | C7H15N3O4S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-methyl-1-[(Z)-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentylidene]amino]thiourea |
| SMILES | CN(/N=C\[C@@H](O)[C@H](O)[C@H](O)CO)C(N)=S |
| InChI | InChI=1S/C7H15N3O4S/c1-10(7(8)15)9-2-4(12)6(14)5(13)3-11/h2,4-6,11-14H,3H2,1H3,(H2,8,15)/b9-2-/t4-,5-,6+/m1/s1 |
| InChIKey | MSWCOIJMYHXTHM-CCUFIRFPSA-N |
| XLogP | -2.78 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|