C15H18ClN3O4S — CID 11726721
(2S,3R,4S,5Z)-5-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-methylhydrazinylidene]pentane-1,2,3,4-tetrol (PubChem CID 11726721) has the molecular formula C15H18ClN3O4S and a molecular weight of 371.85 g/mol. Its IUPAC name is (2S,3R,4S,5Z)-5-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-methylhydrazinylidene]pentane-1,2,3,4-tetrol.
| Compound Name | (2S,3R,4S,5Z)-5-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-methylhydrazinylidene]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11726721 |
| Molecular Formula | C15H18ClN3O4S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | (2S,3R,4S,5Z)-5-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-methylhydrazinylidene]pentane-1,2,3,4-tetrol |
| SMILES | CN(/N=C\[C@H](O)[C@@H](O)[C@@H](O)CO)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C15H18ClN3O4S/c1-19(17-6-12(21)14(23)13(22)7-20)15-18-11(8-24-15)9-2-4-10(16)5-3-9/h2-6,8,12-14,20-23H,7H2,1H3/b17-6-/t12-,13-,14+/m0/s1 |
| InChIKey | NDSRJIRGZYHWDZ-HOFQKTPDSA-N |
| XLogP | 0.96 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|