C12H14N2O3S — CID 170818652
1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]propane-1,2,3-triol (PubChem CID 170818652) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]propane-1,2,3-triol.
| Compound Name | 1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818652 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]propane-1,2,3-triol |
| SMILES | Nc1nc(-c2ccc(C(O)C(O)CO)cc2)cs1 |
| InChI | InChI=1S/C12H14N2O3S/c13-12-14-9(6-18-12)7-1-3-8(4-2-7)11(17)10(16)5-15/h1-4,6,10-11,15-17H,5H2,(H2,13,14) |
| InChIKey | BBZYCEIEEXGUBN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |