C9H8N2O3S2 — CID 88812082
4-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid (PubChem CID 88812082) has the molecular formula C9H8N2O3S2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 4-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid.
| Compound Name | 4-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 88812082 |
| Molecular Formula | C9H8N2O3S2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 4-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid |
| SMILES | Nc1nc(-c2ccc(S(=O)(=O)O)cc2)cs1 |
| InChI | InChI=1S/C9H8N2O3S2/c10-9-11-8(5-15-9)6-1-3-7(4-2-6)16(12,13)14/h1-5H,(H2,10,11)(H,12,13,14) |
| InChIKey | VPEDXIOKIIHHJF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|