C10H10N3O2S2- — CID 174235291
2-amino-4-[4-[(sulfinatoamino)methyl]phenyl]-1,3-thiazole (PubChem CID 174235291) has the molecular formula C10H10N3O2S2- and a molecular weight of 268.34 g/mol. Its IUPAC name is 2-amino-4-[4-[(sulfinatoamino)methyl]phenyl]-1,3-thiazole.
| Compound Name | 2-amino-4-[4-[(sulfinatoamino)methyl]phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 174235291 |
| Molecular Formula | C10H10N3O2S2- |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 2-amino-4-[4-[(sulfinatoamino)methyl]phenyl]-1,3-thiazole |
| SMILES | Nc1nc(-c2ccc(CNS(=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C10H11N3O2S2/c11-10-13-9(6-16-10)8-3-1-7(2-4-8)5-12-17(14)15/h1-4,6,12H,5H2,(H2,11,13)(H,14,15)/p-1 |
| InChIKey | IRVXNNRJDIIQDO-UHFFFAOYSA-M |
| XLogP | 1.28 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|