C16H12F2N3O3S2- — CID 57315685
2-amino-4-[3-[(2,4-difluorophenoxy)methyl]-4-(sulfinatoamino)phenyl]-1,3-thiazole (PubChem CID 57315685) has the molecular formula C16H12F2N3O3S2- and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-amino-4-[3-[(2,4-difluorophenoxy)methyl]-4-(sulfinatoamino)phenyl]-1,3-thiazole.
| Compound Name | 2-amino-4-[3-[(2,4-difluorophenoxy)methyl]-4-(sulfinatoamino)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 57315685 |
| Molecular Formula | C16H12F2N3O3S2- |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 2-amino-4-[3-[(2,4-difluorophenoxy)methyl]-4-(sulfinatoamino)phenyl]-1,3-thiazole |
| SMILES | Nc1nc(-c2ccc(NS(=O)[O-])c(COc3ccc(F)cc3F)c2)cs1 |
| InChI | InChI=1S/C16H13F2N3O3S2/c17-11-2-4-15(12(18)6-11)24-7-10-5-9(14-8-25-16(19)20-14)1-3-13(10)21-26(22)23/h1-6,8,21H,7H2,(H2,19,20)(H,22,23)/p-1 |
| InChIKey | OJQOTIYMIOVDPN-UHFFFAOYSA-M |
| XLogP | 3.46 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|