C14H12F2NO3S2- — CID 57078139
2-(2,4-difluorophenoxy)-4-(methylsulfanylmethyl)-1-(sulfinatoamino)benzene (PubChem CID 57078139) has the molecular formula C14H12F2NO3S2- and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-4-(methylsulfanylmethyl)-1-(sulfinatoamino)benzene.
| Compound Name | 2-(2,4-difluorophenoxy)-4-(methylsulfanylmethyl)-1-(sulfinatoamino)benzene |
|---|---|
| PubChem CID | 57078139 |
| Molecular Formula | C14H12F2NO3S2- |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-4-(methylsulfanylmethyl)-1-(sulfinatoamino)benzene |
| SMILES | CSCc1ccc(NS(=O)[O-])c(Oc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C14H13F2NO3S2/c1-21-8-9-2-4-12(17-22(18)19)14(6-9)20-13-5-3-10(15)7-11(13)16/h2-7,17H,8H2,1H3,(H,18,19)/p-1 |
| InChIKey | BGWAEUABWTWUAN-UHFFFAOYSA-M |
| XLogP | 3.83 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|