C16H13F2NO2S — CID 142003228
6-(2,4-difluorophenoxy)-5-(methylsulfanylamino)-2,3-dihydroinden-1-one (PubChem CID 142003228) has the molecular formula C16H13F2NO2S and a molecular weight of 321.35 g/mol. Its IUPAC name is 6-(2,4-difluorophenoxy)-5-(methylsulfanylamino)-2,3-dihydroinden-1-one.
| Compound Name | 6-(2,4-difluorophenoxy)-5-(methylsulfanylamino)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 142003228 |
| Molecular Formula | C16H13F2NO2S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 6-(2,4-difluorophenoxy)-5-(methylsulfanylamino)-2,3-dihydroinden-1-one |
| SMILES | CSNc1cc2c(cc1Oc1ccc(F)cc1F)C(=O)CC2 |
| InChI | InChI=1S/C16H13F2NO2S/c1-22-19-13-6-9-2-4-14(20)11(9)8-16(13)21-15-5-3-10(17)7-12(15)18/h3,5-8,19H,2,4H2,1H3 |
| InChIKey | UVZCGUYEGIMZHW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|