C10H14O2S — CID 12637716
1,2-dimethoxy-4-(methylsulfanylmethyl)benzene (PubChem CID 12637716) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is 1,2-dimethoxy-4-(methylsulfanylmethyl)benzene.
| Compound Name | 1,2-dimethoxy-4-(methylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 12637716 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1,2-dimethoxy-4-(methylsulfanylmethyl)benzene |
| SMILES | COc1ccc(CSC)cc1OC |
| InChI | InChI=1S/C10H14O2S/c1-11-9-5-4-8(7-13-3)6-10(9)12-2/h4-6H,7H2,1-3H3 |
| InChIKey | GMYATIFKQFLRAB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |