C22H19F2N2O4S- — CID 135285083
3-[2-(2,4-difluorophenoxy)-5-[(sulfinatoamino)methyl]phenyl]-1-methyl-7-oxo-2,4,5,6-tetrahydroisoindole (PubChem CID 135285083) has the molecular formula C22H19F2N2O4S- and a molecular weight of 445.47 g/mol. Its IUPAC name is 3-[2-(2,4-difluorophenoxy)-5-[(sulfinatoamino)methyl]phenyl]-1-methyl-7-oxo-2,4,5,6-tetrahydroisoindole.
| Compound Name | 3-[2-(2,4-difluorophenoxy)-5-[(sulfinatoamino)methyl]phenyl]-1-methyl-7-oxo-2,4,5,6-tetrahydroisoindole |
|---|---|
| PubChem CID | 135285083 |
| Molecular Formula | C22H19F2N2O4S- |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 3-[2-(2,4-difluorophenoxy)-5-[(sulfinatoamino)methyl]phenyl]-1-methyl-7-oxo-2,4,5,6-tetrahydroisoindole |
| SMILES | Cc1[nH]c(-c2cc(CNS(=O)[O-])ccc2Oc2ccc(F)cc2F)c2c1C(=O)CCC2 |
| InChI | InChI=1S/C22H20F2N2O4S/c1-12-21-15(3-2-4-18(21)27)22(26-12)16-9-13(11-25-31(28)29)5-7-19(16)30-20-8-6-14(23)10-17(20)24/h5-10,25-26H,2-4,11H2,1H3,(H,28,29)/p-1 |
| InChIKey | BQWFMOGXCANZHQ-UHFFFAOYSA-M |
| XLogP | 4.46 |
| TPSA | 94.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|