C20H14F2NO4S- — CID 57187857
2-(2,4-difluorophenoxy)-4-phenacyl-1-(sulfinatoamino)benzene (PubChem CID 57187857) has the molecular formula C20H14F2NO4S- and a molecular weight of 402.40 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-4-phenacyl-1-(sulfinatoamino)benzene.
| Compound Name | 2-(2,4-difluorophenoxy)-4-phenacyl-1-(sulfinatoamino)benzene |
|---|---|
| PubChem CID | 57187857 |
| Molecular Formula | C20H14F2NO4S- |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-4-phenacyl-1-(sulfinatoamino)benzene |
| SMILES | O=C(Cc1ccc(NS(=O)[O-])c(Oc2ccc(F)cc2F)c1)c1ccccc1 |
| InChI | InChI=1S/C20H15F2NO4S/c21-15-7-9-19(16(22)12-15)27-20-11-13(6-8-17(20)23-28(25)26)10-18(24)14-4-2-1-3-5-14/h1-9,11-12,23H,10H2,(H,25,26)/p-1 |
| InChIKey | YXSBYVYTJJOGAQ-UHFFFAOYSA-M |
| XLogP | 4.39 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|