C12H15N3O2S — CID 168950454
4-[3-amino-4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-amine (PubChem CID 168950454) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-[3-amino-4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[3-amino-4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168950454 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-[3-amino-4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-amine |
| SMILES | COCCOc1ccc(-c2csc(N)n2)cc1N |
| InChI | InChI=1S/C12H15N3O2S/c1-16-4-5-17-11-3-2-8(6-9(11)13)10-7-18-12(14)15-10/h2-3,6-7H,4-5,13H2,1H3,(H2,14,15) |
| InChIKey | ANTXEEHNWOWEEF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|