C18H17N3O3S — CID 23102404
N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3,4-dimethoxybenzamide (PubChem CID 23102404) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 23102404 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(-c3csc(N)n3)cc2)cc1OC |
| InChI | InChI=1S/C18H17N3O3S/c1-23-15-8-5-12(9-16(15)24-2)17(22)20-13-6-3-11(4-7-13)14-10-25-18(19)21-14/h3-10H,1-2H3,(H2,19,21)(H,20,22) |
| InChIKey | YYUHHRGBAYSGMJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |