C14H15N3OS — CID 82057793
2-[2-amino-4-(2-propyl-1,3-thiazol-4-yl)phenoxy]acetonitrile (PubChem CID 82057793) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-[2-amino-4-(2-propyl-1,3-thiazol-4-yl)phenoxy]acetonitrile.
| Compound Name | 2-[2-amino-4-(2-propyl-1,3-thiazol-4-yl)phenoxy]acetonitrile |
|---|---|
| PubChem CID | 82057793 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-[2-amino-4-(2-propyl-1,3-thiazol-4-yl)phenoxy]acetonitrile |
| SMILES | CCCc1nc(-c2ccc(OCC#N)c(N)c2)cs1 |
| InChI | InChI=1S/C14H15N3OS/c1-2-3-14-17-12(9-19-14)10-4-5-13(11(16)8-10)18-7-6-15/h4-5,8-9H,2-3,7,16H2,1H3 |
| InChIKey | HAAUDOQFSQOULG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|