C16H12N4OS — CID 93205683
2-[2-amino-4-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenoxy]acetonitrile (PubChem CID 93205683) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is 2-[2-amino-4-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenoxy]acetonitrile.
| Compound Name | 2-[2-amino-4-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenoxy]acetonitrile |
|---|---|
| PubChem CID | 93205683 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-[2-amino-4-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenoxy]acetonitrile |
| SMILES | N#CCOc1ccc(-c2csc(-c3ccccn3)n2)cc1N |
| InChI | InChI=1S/C16H12N4OS/c17-6-8-21-15-5-4-11(9-12(15)18)14-10-22-16(20-14)13-3-1-2-7-19-13/h1-5,7,9-10H,8,18H2 |
| InChIKey | QPISEQCJBODDTQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|