C14H14N2S — CID 116866782
3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]propanenitrile (PubChem CID 116866782) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is 3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]propanenitrile.
| Compound Name | 3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]propanenitrile |
|---|---|
| PubChem CID | 116866782 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]propanenitrile |
| SMILES | Cc1ccc(-c2csc(CCC#N)n2)cc1C |
| InChI | InChI=1S/C14H14N2S/c1-10-5-6-12(8-11(10)2)13-9-17-14(16-13)4-3-7-15/h5-6,8-9H,3-4H2,1-2H3 |
| InChIKey | IVHBWTKHBVJRHR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |