C16H21N3O2S — CID 86620276
2-[4-(2-amino-1,3-thiazol-4-yl)phenyl]ethyl-tert-butylcarbamic acid (PubChem CID 86620276) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-[4-(2-amino-1,3-thiazol-4-yl)phenyl]ethyl-tert-butylcarbamic acid.
| Compound Name | 2-[4-(2-amino-1,3-thiazol-4-yl)phenyl]ethyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 86620276 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-[4-(2-amino-1,3-thiazol-4-yl)phenyl]ethyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CCc1ccc(-c2csc(N)n2)cc1)C(=O)O |
| InChI | InChI=1S/C16H21N3O2S/c1-16(2,3)19(15(20)21)9-8-11-4-6-12(7-5-11)13-10-22-14(17)18-13/h4-7,10H,8-9H2,1-3H3,(H2,17,18)(H,20,21) |
| InChIKey | SVQJSYZIWJURFW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |