C16H11ClFN3OS — CID 91558416
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-fluorobenzohydrazide (PubChem CID 91558416) has the molecular formula C16H11ClFN3OS and a molecular weight of 347.80 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-fluorobenzohydrazide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 91558416 |
| Molecular Formula | C16H11ClFN3OS |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-fluorobenzohydrazide |
| SMILES | NN(C(=O)c1ccccc1F)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C16H11ClFN3OS/c17-11-7-5-10(6-8-11)14-9-23-16(20-14)21(19)15(22)12-3-1-2-4-13(12)18/h1-9H,19H2 |
| InChIKey | LXETVCVXZYTRRQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|