C15H11BrN4OS — CID 90803773
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]pyridine-3-carbohydrazide (PubChem CID 90803773) has the molecular formula C15H11BrN4OS and a molecular weight of 375.25 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]pyridine-3-carbohydrazide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 90803773 |
| Molecular Formula | C15H11BrN4OS |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]pyridine-3-carbohydrazide |
| SMILES | NN(C(=O)c1cccnc1)c1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C15H11BrN4OS/c16-12-5-3-10(4-6-12)13-9-22-15(19-13)20(17)14(21)11-2-1-7-18-8-11/h1-9H,17H2 |
| InChIKey | AXLVORTZHPVXCZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|