C7H15N3O6 — CID 129449936
[(Z)-[(2S,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]urea (PubChem CID 129449936) has the molecular formula C7H15N3O6 and a molecular weight of 237.21 g/mol. Its IUPAC name is [(Z)-[(2S,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]urea.
| Compound Name | [(Z)-[(2S,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]urea |
|---|---|
| PubChem CID | 129449936 |
| Molecular Formula | C7H15N3O6 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | [(Z)-[(2S,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]urea |
| SMILES | NC(=O)N/N=C\[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15N3O6/c8-7(16)10-9-1-3(12)5(14)6(15)4(13)2-11/h1,3-6,11-15H,2H2,(H3,8,10,16)/b9-1-/t3-,4+,5-,6-/m0/s1 |
| InChIKey | NOUQGOYNEGWDCZ-VJDOBWRRSA-N |
| XLogP | -3.92 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|