C15H22N2O7 — CID 20844228
4-ethoxy-N-[(E)-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]benzamide (PubChem CID 20844228) has the molecular formula C15H22N2O7 and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-ethoxy-N-[(E)-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]benzamide.
| Compound Name | 4-ethoxy-N-[(E)-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]benzamide |
|---|---|
| PubChem CID | 20844228 |
| Molecular Formula | C15H22N2O7 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-ethoxy-N-[(E)-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]amino]benzamide |
| SMILES | CCOc1ccc(C(=O)N/N=C/[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)cc1 |
| InChI | InChI=1S/C15H22N2O7/c1-2-24-10-5-3-9(4-6-10)15(23)17-16-7-11(19)13(21)14(22)12(20)8-18/h3-7,11-14,18-22H,2,8H2,1H3,(H,17,23)/b16-7+/t11-,12+,13+,14+/m0/s1 |
| InChIKey | HUFUGVLFCQLFHW-NJFKLVBYSA-N |
| XLogP | -1.76 |
| TPSA | 151.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|