C18H30N2O6 — CID 5158678
2-(1-adamantyl)-N-(2,3,4,5,6-pentahydroxyhexylideneamino)acetamide (PubChem CID 5158678) has the molecular formula C18H30N2O6 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(2,3,4,5,6-pentahydroxyhexylideneamino)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(2,3,4,5,6-pentahydroxyhexylideneamino)acetamide |
|---|---|
| PubChem CID | 5158678 |
| Molecular Formula | C18H30N2O6 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 2-(1-adamantyl)-N-(2,3,4,5,6-pentahydroxyhexylideneamino)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NN=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C18H30N2O6/c21-9-14(23)17(26)16(25)13(22)8-19-20-15(24)7-18-4-10-1-11(5-18)3-12(2-10)6-18/h8,10-14,16-17,21-23,25-26H,1-7,9H2,(H,20,24) |
| InChIKey | VIAFSBBLPXJDNB-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|