C17H23N3OS — CID 9122743
2-(1-adamantyl)-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]acetamide (PubChem CID 9122743) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9122743 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-(1-adamantyl)-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]acetamide |
| SMILES | Cc1nc(/C=N\NC(=O)CC23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C17H23N3OS/c1-11-19-15(10-22-11)9-18-20-16(21)8-17-5-12-2-13(6-17)4-14(3-12)7-17/h9-10,12-14H,2-8H2,1H3,(H,20,21)/b18-9- |
| InChIKey | XQVNGZQBFIZTKT-NVMNQCDNSA-N |
| XLogP | 3.51 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|