C12H10BrN3OS — CID 9016496
2-bromo-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]benzamide (PubChem CID 9016496) has the molecular formula C12H10BrN3OS and a molecular weight of 324.20 g/mol. Its IUPAC name is 2-bromo-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 9016496 |
| Molecular Formula | C12H10BrN3OS |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | 2-bromo-N-[(Z)-(2-methyl-1,3-thiazol-4-yl)methylideneamino]benzamide |
| SMILES | Cc1nc(/C=N\NC(=O)c2ccccc2Br)cs1 |
| InChI | InChI=1S/C12H10BrN3OS/c1-8-15-9(7-18-8)6-14-16-12(17)10-4-2-3-5-11(10)13/h2-7H,1H3,(H,16,17)/b14-6- |
| InChIKey | ZOICJLCBHAQURO-NSIKDUERSA-N |
| XLogP | 2.98 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|