C11H24ClN3O6 — CID 131884104
trimethyl-[2-oxo-2-[2-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]ethyl]azanium chloride (PubChem CID 131884104) has the molecular formula C11H24ClN3O6 and a molecular weight of 329.78 g/mol. Its IUPAC name is trimethyl-[2-oxo-2-[2-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]ethyl]azanium chloride.
| Compound Name | trimethyl-[2-oxo-2-[2-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]ethyl]azanium chloride |
|---|---|
| PubChem CID | 131884104 |
| Molecular Formula | C11H24ClN3O6 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | trimethyl-[2-oxo-2-[2-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexylidene]hydrazinyl]ethyl]azanium chloride |
| SMILES | C[N+](C)(C)CC(=O)NN=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[Cl-] |
| InChI | InChI=1S/C11H23N3O6.ClH/c1-14(2,3)5-9(18)13-12-4-7(16)10(19)11(20)8(17)6-15;/h4,7-8,10-11,15-17,19-20H,5-6H2,1-3H3;1H/t7-,8+,10+,11+;/m0./s1 |
| InChIKey | QVQQSRKHVZYNLI-QRFAEMBQSA-N |
| XLogP | -6.77 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | -6.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|