C13H28N6O2+2 — CID 6800245
Trimethyl-[2-oxo-2-[2-[1-[[2-(trimethylazaniumyl)acetyl]hydrazinylidene]propan-2-ylidene]hydrazinyl]ethyl]azanium (PubChem CID 6800245) has the molecular formula C13H28N6O2+2 and a molecular weight of 300.40 g/mol. Its IUPAC name is trimethyl-[2-oxo-2-[2-[1-[[2-(trimethylazaniumyl)acetyl]hydrazinylidene]propan-2-ylidene]hydrazinyl]ethyl]azanium.
| Compound Name | Trimethyl-[2-oxo-2-[2-[1-[[2-(trimethylazaniumyl)acetyl]hydrazinylidene]propan-2-ylidene]hydrazinyl]ethyl]azanium |
|---|---|
| PubChem CID | 6800245 |
| Molecular Formula | C13H28N6O2+2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | trimethyl-[2-oxo-2-[2-[1-[[2-(trimethylazaniumyl)acetyl]hydrazinylidene]propan-2-ylidene]hydrazinyl]ethyl]azanium |
| SMILES | CC(=NNC(=O)C[N+](C)(C)C)C=NNC(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C13H26N6O2/c1-11(15-17-13(21)10-19(5,6)7)8-14-16-12(20)9-18(2,3)4/h8H,9-10H2,1-7H3/p+2 |
| InChIKey | WGYPFZGAWKZAEA-UHFFFAOYSA-P |
| XLogP | -0.60 |
| TPSA | 82.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | 429 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|