C12H26N2O5 — CID 121006907
(2R,3S,4R,5S,6E)-6-(hexylhydrazinylidene)hexane-1,2,3,4,5-pentol (PubChem CID 121006907) has the molecular formula C12H26N2O5 and a molecular weight of 278.35 g/mol. Its IUPAC name is (2R,3S,4R,5S,6E)-6-(hexylhydrazinylidene)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3S,4R,5S,6E)-6-(hexylhydrazinylidene)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 121006907 |
| Molecular Formula | C12H26N2O5 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (2R,3S,4R,5S,6E)-6-(hexylhydrazinylidene)hexane-1,2,3,4,5-pentol |
| SMILES | CCCCCCN/N=C/[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H26N2O5/c1-2-3-4-5-6-13-14-7-9(16)11(18)12(19)10(17)8-15/h7,9-13,15-19H,2-6,8H2,1H3/b14-7+/t9-,10+,11+,12-/m0/s1 |
| InChIKey | QUBRRMCAODREHZ-YEAFWYEMSA-N |
| XLogP | -1.42 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|