C7H13N3O6S — CID 124776177
(2R,3S,4S,5S,6Z)-6-(carbamothioylhydrazinylidene)-2,3,4,5-tetrahydroxyhexanoic acid (PubChem CID 124776177) has the molecular formula C7H13N3O6S and a molecular weight of 267.26 g/mol. Its IUPAC name is (2R,3S,4S,5S,6Z)-6-(carbamothioylhydrazinylidene)-2,3,4,5-tetrahydroxyhexanoic acid.
| Compound Name | (2R,3S,4S,5S,6Z)-6-(carbamothioylhydrazinylidene)-2,3,4,5-tetrahydroxyhexanoic acid |
|---|---|
| PubChem CID | 124776177 |
| Molecular Formula | C7H13N3O6S |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | (2R,3S,4S,5S,6Z)-6-(carbamothioylhydrazinylidene)-2,3,4,5-tetrahydroxyhexanoic acid |
| SMILES | NC(=S)N/N=C\[C@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C7H13N3O6S/c8-7(17)10-9-1-2(11)3(12)4(13)5(14)6(15)16/h1-5,11-14H,(H,15,16)(H3,8,10,17)/b9-1-/t2-,3-,4-,5+/m0/s1 |
| InChIKey | FYVFRAZBUUUFJP-KYPONETRSA-N |
| XLogP | -3.67 |
| TPSA | 168.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|