C12H15N3O8 — CID 10640063
(2S,3R,4R,5S,6E)-2,3,4,5-tetrahydroxy-6-[(2-nitrophenyl)hydrazinylidene]hexanoic acid (PubChem CID 10640063) has the molecular formula C12H15N3O8 and a molecular weight of 329.27 g/mol. Its IUPAC name is (2S,3R,4R,5S,6E)-2,3,4,5-tetrahydroxy-6-[(2-nitrophenyl)hydrazinylidene]hexanoic acid.
| Compound Name | (2S,3R,4R,5S,6E)-2,3,4,5-tetrahydroxy-6-[(2-nitrophenyl)hydrazinylidene]hexanoic acid |
|---|---|
| PubChem CID | 10640063 |
| Molecular Formula | C12H15N3O8 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (2S,3R,4R,5S,6E)-2,3,4,5-tetrahydroxy-6-[(2-nitrophenyl)hydrazinylidene]hexanoic acid |
| SMILES | O=C(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)/C=N/Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N3O8/c16-8(9(17)10(18)11(19)12(20)21)5-13-14-6-3-1-2-4-7(6)15(22)23/h1-5,8-11,14,16-19H,(H,20,21)/b13-5+/t8-,9+,10+,11-/m0/s1 |
| InChIKey | VMKIJFHGGKFPPA-FWQZGJKDSA-N |
| XLogP | -1.48 |
| TPSA | 185.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|