C12H17N3O6 — CID 92973943
(1Z,2R,3R,4S,5S)-1-[(2-nitrophenyl)hydrazinylidene]hexane-2,3,4,5-tetrol (PubChem CID 92973943) has the molecular formula C12H17N3O6 and a molecular weight of 299.28 g/mol. Its IUPAC name is (1Z,2R,3R,4S,5S)-1-[(2-nitrophenyl)hydrazinylidene]hexane-2,3,4,5-tetrol.
| Compound Name | (1Z,2R,3R,4S,5S)-1-[(2-nitrophenyl)hydrazinylidene]hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 92973943 |
| Molecular Formula | C12H17N3O6 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (1Z,2R,3R,4S,5S)-1-[(2-nitrophenyl)hydrazinylidene]hexane-2,3,4,5-tetrol |
| SMILES | C[C@H](O)[C@H](O)[C@H](O)[C@H](O)/C=N\Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O6/c1-7(16)11(18)12(19)10(17)6-13-14-8-4-2-3-5-9(8)15(20)21/h2-7,10-12,14,16-19H,1H3/b13-6-/t7-,10+,11-,12+/m0/s1 |
| InChIKey | WBEGFALJHNFNFY-GQUGQUJISA-N |
| XLogP | -0.54 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|