C5H10O12S2 — CID 129202505
sulfooxy [(2R,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] sulfate (PubChem CID 129202505) has the molecular formula C5H10O12S2 and a molecular weight of 326.26 g/mol. Its IUPAC name is sulfooxy [(2R,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] sulfate.
| Compound Name | sulfooxy [(2R,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] sulfate |
|---|---|
| PubChem CID | 129202505 |
| Molecular Formula | C5H10O12S2 |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.96 |
| IUPAC Name | sulfooxy [(2R,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] sulfate |
| SMILES | O=C[C@H](OS(=O)(=O)OOS(=O)(=O)O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H10O12S2/c6-1-3(8)5(9)4(2-7)15-19(13,14)17-16-18(10,11)12/h2-6,8-9H,1H2,(H,10,11,12)/t3-,4+,5+/m1/s1 |
| InChIKey | HKONQEGNFDZWAR-WISUUJSJSA-N |
| XLogP | -3.72 |
| TPSA | 193.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|