C7H20NO8PS — CID 121334059
methane;phosphane;[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid (PubChem CID 121334059) has the molecular formula C7H20NO8PS and a molecular weight of 309.28 g/mol. Its IUPAC name is methane;phosphane;[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid.
| Compound Name | methane;phosphane;[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid |
|---|---|
| PubChem CID | 121334059 |
| Molecular Formula | C7H20NO8PS |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | methane;phosphane;[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]sulfamic acid |
| SMILES | C.O=C[C@H](NS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H](O)CO.P |
| InChI | InChI=1S/C6H13NO8S.CH4.H3P/c8-1-3(7-16(13,14)15)5(11)6(12)4(10)2-9;;/h1,3-7,9-12H,2H2,(H,13,14,15);1H4;1H3/t3-,4+,5+,6+;;/m0../s1 |
| InChIKey | HFDSHMBZSNBOEN-FAOVPRGRSA-N |
| XLogP | -3.28 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|