C9H19NO8S — CID 141059913
3-[deuterio-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]propane-1-sulfonic acid (PubChem CID 141059913) has the molecular formula C9H19NO8S and a molecular weight of 302.32 g/mol. Its IUPAC name is 3-[deuterio-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[deuterio-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 141059913 |
| Molecular Formula | C9H19NO8S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-[deuterio-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]amino]propane-1-sulfonic acid |
| SMILES | [2H]N(CCCS(=O)(=O)O)[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H19NO8S/c11-4-6(8(14)9(15)7(13)5-12)10-2-1-3-19(16,17)18/h4,6-10,12-15H,1-3,5H2,(H,16,17,18)/t6-,7+,8+,9+/m0/s1/i/hD |
| InChIKey | ROBROPVZRNGGPP-JUJCMYMASA-N |
| XLogP | -3.50 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|