C9H16O8 — CID 18641746
2-[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxypropanoic acid (PubChem CID 18641746) has the molecular formula C9H16O8 and a molecular weight of 252.22 g/mol. Its IUPAC name is 2-[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxypropanoic acid.
| Compound Name | 2-[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 18641746 |
| Molecular Formula | C9H16O8 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxypropanoic acid |
| SMILES | CC(O[C@@H](C=O)[C@@H](O)[C@@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C9H16O8/c1-4(9(15)16)17-6(3-11)8(14)7(13)5(12)2-10/h3-8,10,12-14H,2H2,1H3,(H,15,16)/t4?,5-,6+,7+,8-/m1/s1 |
| InChIKey | MPRMOXGQPSEQSB-APUAGWDISA-N |
| XLogP | -2.88 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|