C10H17NO9 — CID 57134654
(2S)-2-amino-4-oxo-4-[(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxybutanoic acid (PubChem CID 57134654) has the molecular formula C10H17NO9 and a molecular weight of 295.24 g/mol. Its IUPAC name is (2S)-2-amino-4-oxo-4-[(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxybutanoic acid.
| Compound Name | (2S)-2-amino-4-oxo-4-[(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 57134654 |
| Molecular Formula | C10H17NO9 |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | (2S)-2-amino-4-oxo-4-[(2S,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]oxybutanoic acid |
| SMILES | N[C@@H](CC(=O)O[C@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C10H17NO9/c11-4(10(18)19)1-7(15)20-6(3-13)9(17)8(16)5(14)2-12/h3-6,8-9,12,14,16-17H,1-2,11H2,(H,18,19)/t4-,5+,6+,8+,9+/m0/s1 |
| InChIKey | YEQYQLJSJXNRAD-CDNNUPQJSA-N |
| XLogP | -4.03 |
| TPSA | 187.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | -4.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|