C18H32O19 — CID 174335379
2-hydroxypropane-1,2,3-tricarboxylic acid;2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 174335379) has the molecular formula C18H32O19 and a molecular weight of 552.44 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 174335379 |
| Molecular Formula | C18H32O19 |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;2,3,4,5,6-pentahydroxyhexanal;1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | O=C(CO)C(O)C(O)C(O)CO.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=CC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H8O7.2C6H12O6/c7-3(8)1-6(13,5(11)12)2-4(9)10;2*7-1-3(9)5(11)6(12)4(10)2-8/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);3,5-9,11-12H,1-2H2;1,3-6,8-12H,2H2 |
| InChIKey | DICAMKKRQZNKMW-UHFFFAOYSA-N |
| XLogP | -8.00 |
| TPSA | 368.57 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | -8.00 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|