C16H27NO17 — CID 160666361
(2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 160666361) has the molecular formula C16H27NO17 and a molecular weight of 505.38 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 160666361 |
| Molecular Formula | C16H27NO17 |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid;(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | N[C@@H](CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O.O=C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H8O7.C6H12O6.C4H7NO4/c7-3(8)1-6(13,5(11)12)2-4(9)10;7-1-3(9)5(11)6(12)4(10)2-8;5-2(4(8)9)1-3(6)7/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1,3-6,8-12H,2H2;2H,1,5H2,(H,6,7)(H,8,9)/t;3-,4-,5-,6-;2-/m.10/s1 |
| InChIKey | RMIVJNKKIBQENJ-ZWXGXGGXSA-N |
| XLogP | -5.75 |
| TPSA | 350.97 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | -5.75 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|