C10H15NO11 — CID 86749178
(2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 86749178) has the molecular formula C10H15NO11 and a molecular weight of 325.23 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 86749178 |
| Molecular Formula | C10H15NO11 |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.C4H7NO4/c7-3(8)1-6(13,5(11)12)2-4(9)10;5-2(4(8)9)1-3(6)7/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.0/s1 |
| InChIKey | WVMZGOKTAJOYIQ-WNQIDUERSA-N |
| XLogP | -2.38 |
| TPSA | 232.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |