(2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid

C10H15NO11 — CID 86749178

IUPAC(2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid
SMILESN[C@@H](CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O
InChIInChI=1S/C6H8O7.C4H7NO4/c7-3(8)1-6(13,5(11)12)2-4(9)10;5-2(4(8)9)1-3(6)7/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.0/s1
InChIKeyWVMZGOKTAJOYIQ-WNQIDUERSA-N
MW325.23 g/mol
LogP-2.38
Rot. Bonds8

About (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid

(2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 86749178) has the molecular formula C10H15NO11 and a molecular weight of 325.23 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid.

Molecular Properties

Compound Name(2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid
PubChem CID86749178
Molecular FormulaC10H15NO11
Molecular Weight325.23 g/mol
Exact Mass325.06
IUPAC Name(2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid
SMILESN[C@@H](CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O
InChIInChI=1S/C6H8O7.C4H7NO4/c7-3(8)1-6(13,5(11)12)2-4(9)10;5-2(4(8)9)1-3(6)7/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.0/s1
InChIKeyWVMZGOKTAJOYIQ-WNQIDUERSA-N
XLogP-2.38
TPSA232.75 Ų
H-Bond Donors7
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500325.23
LogP ≤ 5-2.38
H-Bond Donors ≤ 57
H-Bond Acceptors ≤ 107

Analyze (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid?
The IUPAC name of (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid (CID 86749178) is (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid.
What is the SMILES notation for (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid?
The canonical SMILES for (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid is N[C@@H](CC(=O)O)C(=O)O.O=C(O)CC(O)(CC(=O)O)C(=O)O.
What is the InChIKey of (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid?
The InChIKey is WVMZGOKTAJOYIQ-WNQIDUERSA-N. The full InChI is InChI=1S/C6H8O7.C4H7NO4/c7-3(8)1-6(13,5(11)12)2-4(9)10;5-2(4(8)9)1-3(6)7/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2H,1,5H2,(H,6,7)(H,8,9)/t;2-/m.0/s1.
What are the key properties of (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid?
(2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid has a molecular weight of 325.23 g/mol, XLogP of -2.38, 8 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminobutanedioic acid;2-hydroxypropane-1,2,3-tricarboxylic acid is sourced from PubChem (CID 86749178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).