C12H23NO13 — CID 87393097
azane;2-[2-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 87393097) has the molecular formula C12H23NO13 and a molecular weight of 389.31 g/mol. Its IUPAC name is azane;2-[2-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | azane;2-[2-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 87393097 |
| Molecular Formula | C12H23NO13 |
| Molecular Weight | 389.31 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | azane;2-[2-[(2R,3S,4R,5R)-1,2,3,4,5,6-hexahydroxyhexoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | N.O=C(O)CC(O)(CC(=O)OC(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C12H20O13.H3N/c13-3-4(14)7(18)8(19)9(20)10(21)25-6(17)2-12(24,11(22)23)1-5(15)16;/h4,7-10,13-14,18-21,24H,1-3H2,(H,15,16)(H,22,23);1H3/t4-,7-,8+,9-,10?,12?;/m1./s1 |
| InChIKey | GNMNZJOLFSUAIR-UQFMQTMCSA-N |
| XLogP | -4.87 |
| TPSA | 277.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.31 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|