C9H14O10 — CID 141090549
2-hydroxy-2-[2-oxo-2-(1,1,1-trihydroxypropan-2-yloxy)ethyl]butanedioic acid (PubChem CID 141090549) has the molecular formula C9H14O10 and a molecular weight of 282.20 g/mol. Its IUPAC name is 2-hydroxy-2-[2-oxo-2-(1,1,1-trihydroxypropan-2-yloxy)ethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-oxo-2-(1,1,1-trihydroxypropan-2-yloxy)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 141090549 |
| Molecular Formula | C9H14O10 |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-hydroxy-2-[2-oxo-2-(1,1,1-trihydroxypropan-2-yloxy)ethyl]butanedioic acid |
| SMILES | CC(OC(=O)CC(O)(CC(=O)O)C(=O)O)C(O)(O)O |
| InChI | InChI=1S/C9H14O10/c1-4(9(16,17)18)19-6(12)3-8(15,7(13)14)2-5(10)11/h4,15-18H,2-3H2,1H3,(H,10,11)(H,13,14) |
| InChIKey | DZQSPWGZEIKHEJ-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|