C10H17NO8 — CID 57271405
2-[2-(1-amino-3-methoxypropoxy)-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 57271405) has the molecular formula C10H17NO8 and a molecular weight of 279.24 g/mol. Its IUPAC name is 2-[2-(1-amino-3-methoxypropoxy)-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(1-amino-3-methoxypropoxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 57271405 |
| Molecular Formula | C10H17NO8 |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-[2-(1-amino-3-methoxypropoxy)-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | COCCC(N)OC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17NO8/c1-18-3-2-6(11)19-8(14)5-10(17,9(15)16)4-7(12)13/h6,17H,2-5,11H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | FDJFFIZBXVNCTI-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|