C10H18O8 — CID 87196720
5-oxo-5-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentoxy]pentanoic acid (PubChem CID 87196720) has the molecular formula C10H18O8 and a molecular weight of 266.25 g/mol. Its IUPAC name is 5-oxo-5-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentoxy]pentanoic acid.
| Compound Name | 5-oxo-5-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentoxy]pentanoic acid |
|---|---|
| PubChem CID | 87196720 |
| Molecular Formula | C10H18O8 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 5-oxo-5-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentoxy]pentanoic acid |
| SMILES | O=C(O)CCCC(=O)OC[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C10H18O8/c11-4-6(12)10(17)7(13)5-18-9(16)3-1-2-8(14)15/h6-7,10-13,17H,1-5H2,(H,14,15)/t6-,7+,10+/m1/s1 |
| InChIKey | UGZWYFYYULLHAE-FWWHASMVSA-N |
| XLogP | -2.14 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |