C12H24O7 — CID 87972494
6-(2-hydroxypropoxy)-6-oxohexanoic acid;propane-1,2-diol (PubChem CID 87972494) has the molecular formula C12H24O7 and a molecular weight of 280.32 g/mol. Its IUPAC name is 6-(2-hydroxypropoxy)-6-oxohexanoic acid;propane-1,2-diol.
| Compound Name | 6-(2-hydroxypropoxy)-6-oxohexanoic acid;propane-1,2-diol |
|---|---|
| PubChem CID | 87972494 |
| Molecular Formula | C12H24O7 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 6-(2-hydroxypropoxy)-6-oxohexanoic acid;propane-1,2-diol |
| SMILES | CC(O)CO.CC(O)COC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C9H16O5.C3H8O2/c1-7(10)6-14-9(13)5-3-2-4-8(11)12;1-3(5)2-4/h7,10H,2-6H2,1H3,(H,11,12);3-5H,2H2,1H3 |
| InChIKey | NIEUVYYMPXJNBY-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|