C9H16BrFO3 — CID 101158385
ethyl (2S,3R)-2-bromo-2-fluoro-3-hydroxy-4,4-dimethylpentanoate (PubChem CID 101158385) has the molecular formula C9H16BrFO3 and a molecular weight of 271.13 g/mol. Its IUPAC name is ethyl (2S,3R)-2-bromo-2-fluoro-3-hydroxy-4,4-dimethylpentanoate.
| Compound Name | ethyl (2S,3R)-2-bromo-2-fluoro-3-hydroxy-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 101158385 |
| Molecular Formula | C9H16BrFO3 |
| Molecular Weight | 271.13 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | ethyl (2S,3R)-2-bromo-2-fluoro-3-hydroxy-4,4-dimethylpentanoate |
| SMILES | CCOC(=O)[C@@](F)(Br)[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C9H16BrFO3/c1-5-14-7(13)9(10,11)6(12)8(2,3)4/h6,12H,5H2,1-4H3/t6-,9-/m1/s1 |
| InChIKey | VWMUFXVEZUQKEK-HZGVNTEJSA-N |
| XLogP | 2.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.13 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|