C8H19NOS — CID 135056564
(R)-N-[(2R)-butan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 135056564) has the molecular formula C8H19NOS and a molecular weight of 177.31 g/mol. Its IUPAC name is (R)-N-[(2R)-butan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(2R)-butan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 135056564 |
| Molecular Formula | C8H19NOS |
| Molecular Weight | 177.31 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (R)-N-[(2R)-butan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC[C@@H](C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C8H19NOS/c1-6-7(2)9-11(10)8(3,4)5/h7,9H,6H2,1-5H3/t7-,11-/m1/s1 |
| InChIKey | ADSRPTINFIXAEQ-RDDDGLTNSA-N |
| XLogP | 1.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |