C10H22ClNOS — CID 102254700
N-[(3R)-2-chloro-2-methylpentan-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 102254700) has the molecular formula C10H22ClNOS and a molecular weight of 239.81 g/mol. Its IUPAC name is N-[(3R)-2-chloro-2-methylpentan-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(3R)-2-chloro-2-methylpentan-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 102254700 |
| Molecular Formula | C10H22ClNOS |
| Molecular Weight | 239.81 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-[(3R)-2-chloro-2-methylpentan-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC[C@@H](NS(=O)C(C)(C)C)C(C)(C)Cl |
| InChI | InChI=1S/C10H22ClNOS/c1-7-8(10(5,6)11)12-14(13)9(2,3)4/h8,12H,7H2,1-6H3/t8-,14?/m1/s1 |
| InChIKey | IUNGJLKNZNCARM-ZSYIFEHUSA-N |
| XLogP | 2.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.81 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|