C13H28N2O3S — CID 11266332
(3R)-3-[[(S)-tert-butylsulfinyl]amino]-N-methoxy-N,4,4-trimethylpentanamide (PubChem CID 11266332) has the molecular formula C13H28N2O3S and a molecular weight of 292.45 g/mol. Its IUPAC name is (3R)-3-[[(S)-tert-butylsulfinyl]amino]-N-methoxy-N,4,4-trimethylpentanamide.
| Compound Name | (3R)-3-[[(S)-tert-butylsulfinyl]amino]-N-methoxy-N,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 11266332 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (3R)-3-[[(S)-tert-butylsulfinyl]amino]-N-methoxy-N,4,4-trimethylpentanamide |
| SMILES | CON(C)C(=O)C[C@@H](N[S@@](=O)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H28N2O3S/c1-12(2,3)10(9-11(16)15(7)18-8)14-19(17)13(4,5)6/h10,14H,9H2,1-8H3/t10-,19+/m1/s1 |
| InChIKey | VBNCOJCTCXMRGP-DGIBIBHMSA-N |
| XLogP | 1.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|