About methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate
methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate (PubChem CID 102319727) has the molecular formula C12H25NO4S
and a molecular weight of 279.40 g/mol. Its IUPAC name is methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate |
| PubChem CID | 102319727 |
| Molecular Formula | C12H25NO4S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate |
| SMILES | COC(=O)[C@](C)(O)[C@H](NS(=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C12H25NO4S/c1-8(2)9(12(6,15)10(14)17-7)13-18(16)11(3,4)5/h8-9,13,15H,1-7H3/t9-,12-,18?/m1/s1 |
| InChIKey | WJYUOFZBPVIROQ-CJQIZWAQSA-N |
| XLogP | 0.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate?
The IUPAC name of methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate (CID 102319727) is methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate.
What is the SMILES notation for methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate?
The canonical SMILES for methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate is COC(=O)[C@](C)(O)[C@H](NS(=O)C(C)(C)C)C(C)C.
What is the InChIKey of methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate?
The InChIKey is WJYUOFZBPVIROQ-CJQIZWAQSA-N. The full InChI is InChI=1S/C12H25NO4S/c1-8(2)9(12(6,15)10(14)17-7)13-18(16)11(3,4)5/h8-9,13,15H,1-7H3/t9-,12-,18?/m1/s1.
What are the key properties of methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate?
methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate has a molecular weight of 279.40 g/mol, XLogP of 0.99, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,3R)-3-(tert-butylsulfinylamino)-2-hydroxy-2,4-dimethylpentanoate is sourced from PubChem (CID 102319727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).