C12H21NO2S — CID 129150722
(R)-N-[(1R)-1-deuterio-1-(5-methylfuran-2-yl)propyl]-2-methylpropane-2-sulfinamide (PubChem CID 129150722) has the molecular formula C12H21NO2S and a molecular weight of 244.38 g/mol. Its IUPAC name is (R)-N-[(1R)-1-deuterio-1-(5-methylfuran-2-yl)propyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-1-deuterio-1-(5-methylfuran-2-yl)propyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 129150722 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (R)-N-[(1R)-1-deuterio-1-(5-methylfuran-2-yl)propyl]-2-methylpropane-2-sulfinamide |
| SMILES | [2H][C@](CC)(N[S@](=O)C(C)(C)C)c1ccc(C)o1 |
| InChI | InChI=1S/C12H21NO2S/c1-6-10(11-8-7-9(2)15-11)13-16(14)12(3,4)5/h7-8,10,13H,6H2,1-5H3/t10-,16-/m1/s1/i10D |
| InChIKey | XXKMGMJRQQWSSJ-SQWHWNSCSA-N |
| XLogP | 3.09 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |